C23H21N3O3 — CID 172660057
(1R,9S)-11-(4-hydroxybenzoyl)-4-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 172660057) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is (1R,9S)-11-(4-hydroxybenzoyl)-4-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-(4-hydroxybenzoyl)-4-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 172660057 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (1R,9S)-11-(4-hydroxybenzoyl)-4-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=C(c1ccc(O)cc1)N1C[C@@H]2C[C@H](C1)c1cc(-c3cccnc3)cc(=O)n1C2 |
| InChI | InChI=1S/C23H21N3O3/c27-20-5-3-16(4-6-20)23(29)25-12-15-8-19(14-25)21-9-18(10-22(28)26(21)13-15)17-2-1-7-24-11-17/h1-7,9-11,15,19,27H,8,12-14H2/t15-,19+/m0/s1 |
| InChIKey | NKBQXLHGDYILQW-HNAYVOBHSA-N |
| XLogP | 2.88 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|