C20H20N6O — CID 175645409
N-(4-pyrrolo[2,3-b]pyridin-7-ylcyclohexyl)-2H-benzotriazole-5-carboxamide (PubChem CID 175645409) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is N-(4-pyrrolo[2,3-b]pyridin-7-ylcyclohexyl)-2H-benzotriazole-5-carboxamide.
| Compound Name | N-(4-pyrrolo[2,3-b]pyridin-7-ylcyclohexyl)-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 175645409 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-(4-pyrrolo[2,3-b]pyridin-7-ylcyclohexyl)-2H-benzotriazole-5-carboxamide |
| SMILES | O=C(NC1CCC(n2cccc3ccnc2-3)CC1)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C20H20N6O/c27-20(14-3-8-17-18(12-14)24-25-23-17)22-15-4-6-16(7-5-15)26-11-1-2-13-9-10-21-19(13)26/h1-3,8-12,15-16H,4-7H2,(H,22,27)(H,23,24,25) |
| InChIKey | NKZIATZPCOHEST-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |