C20H22N4O2 — CID 175646445
N-benzyl-N-methyl-3-(oxan-4-yl)imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 175646445) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-(oxan-4-yl)imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | N-benzyl-N-methyl-3-(oxan-4-yl)imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 175646445 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-benzyl-N-methyl-3-(oxan-4-yl)imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cnc2c(c1)ncn2C1CCOCC1 |
| InChI | InChI=1S/C20H22N4O2/c1-23(13-15-5-3-2-4-6-15)20(25)16-11-18-19(21-12-16)24(14-22-18)17-7-9-26-10-8-17/h2-6,11-12,14,17H,7-10,13H2,1H3 |
| InChIKey | USRWMNKYLCYVAD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |