C21H23N3O — CID 3658169
N-benzyl-1-cyclopentyl-N-methylbenzimidazole-5-carboxamide (PubChem CID 3658169) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is N-benzyl-1-cyclopentyl-N-methylbenzimidazole-5-carboxamide.
| Compound Name | N-benzyl-1-cyclopentyl-N-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 3658169 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | N-benzyl-1-cyclopentyl-N-methylbenzimidazole-5-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccc2c(c1)ncn2C1CCCC1 |
| InChI | InChI=1S/C21H23N3O/c1-23(14-16-7-3-2-4-8-16)21(25)17-11-12-20-19(13-17)22-15-24(20)18-9-5-6-10-18/h2-4,7-8,11-13,15,18H,5-6,9-10,14H2,1H3 |
| InChIKey | YGJCPDMBSMZBPD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |