C9H5BF3N5 — CID 175647274
1-boryl-4-((4-(trifluoromethyl)phenyl)diazenyl)-1h-1,2,3-triazole (PubChem CID 175647274) has the molecular formula C9H5BF3N5 and a molecular weight of 250.98 g/mol.
| Compound Name | 1-boryl-4-((4-(trifluoromethyl)phenyl)diazenyl)-1h-1,2,3-triazole |
|---|---|
| PubChem CID | 175647274 |
| Molecular Formula | C9H5BF3N5 |
| Molecular Weight | 250.98 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | — |
| SMILES | [B]n1cc(/N=N/c2ccc(C(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C9H5BF3N5/c10-18-5-8(16-17-18)15-14-7-3-1-6(2-4-7)9(11,12)13/h1-5H/b15-14+ |
| InChIKey | NNFSPUNOQAVMQG-CCEZHUSRSA-N |
| XLogP | 2.64 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.98 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|