C19H18N4O2 — CID 175650790
2-(4-benzoylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 175650790) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(4-benzoylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 175650790 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=C(c1ccccc1)N1CCN(c2cc(=O)n3ccccc3n2)CC1 |
| InChI | InChI=1S/C19H18N4O2/c24-18-14-17(20-16-8-4-5-9-23(16)18)21-10-12-22(13-11-21)19(25)15-6-2-1-3-7-15/h1-9,14H,10-13H2 |
| InChIKey | SYNUGSXMYUYSQA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |