C13H16N4O — CID 82276271
2-(1,4-diazepan-1-yl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 82276271) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(1,4-diazepan-1-yl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 82276271 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(N2CCCNCC2)nc2ccccn12 |
| InChI | InChI=1S/C13H16N4O/c18-13-10-12(16-7-3-5-14-6-9-16)15-11-4-1-2-8-17(11)13/h1-2,4,8,10,14H,3,5-7,9H2 |
| InChIKey | XVPKFFWMTLLVIP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |