C14H17ClN6O — CID 175651574
5-chloro-4-[4-(5-ethylpyrimidin-2-yl)piperazin-1-yl]-1H-pyridazin-6-one (PubChem CID 175651574) has the molecular formula C14H17ClN6O and a molecular weight of 320.78 g/mol. Its IUPAC name is 5-chloro-4-[4-(5-ethylpyrimidin-2-yl)piperazin-1-yl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[4-(5-ethylpyrimidin-2-yl)piperazin-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 175651574 |
| Molecular Formula | C14H17ClN6O |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 5-chloro-4-[4-(5-ethylpyrimidin-2-yl)piperazin-1-yl]-1H-pyridazin-6-one |
| SMILES | CCc1cnc(N2CCN(c3cn[nH]c(=O)c3Cl)CC2)nc1 |
| InChI | InChI=1S/C14H17ClN6O/c1-2-10-7-16-14(17-8-10)21-5-3-20(4-6-21)11-9-18-19-13(22)12(11)15/h7-9H,2-6H2,1H3,(H,19,22) |
| InChIKey | RABQEZYNAQSMQQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |