C17H33N3O5 — CID 175652973
2-[3-(dimethylamino)propylamino]-1-(2,6-dimethylpiperidin-1-yl)propan-1-one;oxalic acid (PubChem CID 175652973) has the molecular formula C17H33N3O5 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylamino]-1-(2,6-dimethylpiperidin-1-yl)propan-1-one;oxalic acid.
| Compound Name | 2-[3-(dimethylamino)propylamino]-1-(2,6-dimethylpiperidin-1-yl)propan-1-one;oxalic acid |
|---|---|
| PubChem CID | 175652973 |
| Molecular Formula | C17H33N3O5 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 2-[3-(dimethylamino)propylamino]-1-(2,6-dimethylpiperidin-1-yl)propan-1-one;oxalic acid |
| SMILES | CC(NCCCN(C)C)C(=O)N1C(C)CCCC1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H31N3O.C2H2O4/c1-12-8-6-9-13(2)18(12)15(19)14(3)16-10-7-11-17(4)5;3-1(4)2(5)6/h12-14,16H,6-11H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | OSMZSLGFUXIXBH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|