C19H24ClN — CID 175653158
N-(1-prop-2-enylcyclohexyl)naphthalen-2-amine;hydrochloride (PubChem CID 175653158) has the molecular formula C19H24ClN and a molecular weight of 301.86 g/mol. Its IUPAC name is N-(1-prop-2-enylcyclohexyl)naphthalen-2-amine;hydrochloride.
| Compound Name | N-(1-prop-2-enylcyclohexyl)naphthalen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 175653158 |
| Molecular Formula | C19H24ClN |
| Molecular Weight | 301.86 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N-(1-prop-2-enylcyclohexyl)naphthalen-2-amine;hydrochloride |
| SMILES | C=CCC1(Nc2ccc3ccccc3c2)CCCCC1.Cl |
| InChI | InChI=1S/C19H23N.ClH/c1-2-12-19(13-6-3-7-14-19)20-18-11-10-16-8-4-5-9-17(16)15-18;/h2,4-5,8-11,15,20H,1,3,6-7,12-14H2;1H |
| InChIKey | KKVUIDGMDQMOCM-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.86 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|