C19H38N2O7 — CID 175653310
(2R)-2-amino-1-[(7R,8R,9R)-9-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-1,10-dioxa-5-azacyclotetradec-5-yl]hexan-1-one (PubChem CID 175653310) has the molecular formula C19H38N2O7 and a molecular weight of 406.52 g/mol. Its IUPAC name is (2R)-2-amino-1-[(7R,8R,9R)-9-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-1,10-dioxa-5-azacyclotetradec-5-yl]hexan-1-one.
| Compound Name | (2R)-2-amino-1-[(7R,8R,9R)-9-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-1,10-dioxa-5-azacyclotetradec-5-yl]hexan-1-one |
|---|---|
| PubChem CID | 175653310 |
| Molecular Formula | C19H38N2O7 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | (2R)-2-amino-1-[(7R,8R,9R)-9-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-1,10-dioxa-5-azacyclotetradec-5-yl]hexan-1-one |
| SMILES | CCCC[C@@H](N)C(=O)N1CCCOCCCCO[C@H]([C@H](O)CO)[C@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C19H38N2O7/c1-2-3-7-14(20)19(26)21-8-6-10-27-9-4-5-11-28-18(16(24)13-22)17(25)15(23)12-21/h14-18,22-25H,2-13,20H2,1H3/t14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | LMYQKCORCLUGBH-DUQPFJRNSA-N |
| XLogP | -1.01 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |