C17H34N2O7 — CID 155997093
4-amino-1-[(7R,8R,9R)-9-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-1,10-dioxa-5-azacyclotetradec-5-yl]butan-1-one (PubChem CID 155997093) has the molecular formula C17H34N2O7 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-amino-1-[(7R,8R,9R)-9-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-1,10-dioxa-5-azacyclotetradec-5-yl]butan-1-one.
| Compound Name | 4-amino-1-[(7R,8R,9R)-9-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-1,10-dioxa-5-azacyclotetradec-5-yl]butan-1-one |
|---|---|
| PubChem CID | 155997093 |
| Molecular Formula | C17H34N2O7 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 4-amino-1-[(7R,8R,9R)-9-[(1R)-1,2-dihydroxyethyl]-7,8-dihydroxy-1,10-dioxa-5-azacyclotetradec-5-yl]butan-1-one |
| SMILES | NCCCC(=O)N1CCCOCCCCO[C@H]([C@H](O)CO)[C@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C17H34N2O7/c18-6-3-5-15(23)19-7-4-9-25-8-1-2-10-26-17(14(22)12-20)16(24)13(21)11-19/h13-14,16-17,20-22,24H,1-12,18H2/t13-,14-,16-,17-/m1/s1 |
| InChIKey | NBFJDUGVBOSIEX-MUIFIZLQSA-N |
| XLogP | -1.79 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |