C28H37N3O5 — CID 175653351
(1R,5S,6R,7S)-3-tert-butyl-6-N-(3-methoxyphenyl)-2-N-(2-methylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 175653351) has the molecular formula C28H37N3O5 and a molecular weight of 495.62 g/mol. Its IUPAC name is (1R,5S,6R,7S)-3-tert-butyl-6-N-(3-methoxyphenyl)-2-N-(2-methylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,5S,6R,7S)-3-tert-butyl-6-N-(3-methoxyphenyl)-2-N-(2-methylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 175653351 |
| Molecular Formula | C28H37N3O5 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | (1R,5S,6R,7S)-3-tert-butyl-6-N-(3-methoxyphenyl)-2-N-(2-methylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1cccc(NC(=O)[C@H]2[C@@H]3C=C[C@]4(O3)C(C(=O)NC3CCCCC3C)N(C(C)(C)C)C(=O)[C@@H]24)c1 |
| InChI | InChI=1S/C28H37N3O5/c1-16-9-6-7-12-19(16)30-25(33)23-28-14-13-20(36-28)21(22(28)26(34)31(23)27(2,3)4)24(32)29-17-10-8-11-18(15-17)35-5/h8,10-11,13-16,19-23H,6-7,9,12H2,1-5H3,(H,29,32)(H,30,33)/t16?,19?,20-,21-,22+,23?,28+/m0/s1 |
| InChIKey | RGOPWIVLRJUNJF-DXKLNDDBSA-N |
| XLogP | 3.28 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|