C24H25N5O5S — CID 175653415
2-(4-methoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]tetrazole-5-sulfonamide (PubChem CID 175653415) has the molecular formula C24H25N5O5S and a molecular weight of 495.56 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]tetrazole-5-sulfonamide.
| Compound Name | 2-(4-methoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]tetrazole-5-sulfonamide |
|---|---|
| PubChem CID | 175653415 |
| Molecular Formula | C24H25N5O5S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-(4-methoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]tetrazole-5-sulfonamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)S(=O)(=O)c2nnn(-c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C24H25N5O5S/c1-32-21-10-4-18(5-11-21)16-28(17-19-6-12-22(33-2)13-7-19)35(30,31)24-25-27-29(26-24)20-8-14-23(34-3)15-9-20/h4-15H,16-17H2,1-3H3 |
| InChIKey | HCYFGVHXOFZFTF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 108.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |