C24H29FN4O7S — CID 175654234
N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(4-fluorophenyl)-N-(4-methyl-1,3-thiazol-2-yl)butanediamide;oxalic acid (PubChem CID 175654234) has the molecular formula C24H29FN4O7S and a molecular weight of 536.58 g/mol. Its IUPAC name is N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(4-fluorophenyl)-N-(4-methyl-1,3-thiazol-2-yl)butanediamide;oxalic acid.
| Compound Name | N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(4-fluorophenyl)-N-(4-methyl-1,3-thiazol-2-yl)butanediamide;oxalic acid |
|---|---|
| PubChem CID | 175654234 |
| Molecular Formula | C24H29FN4O7S |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | N'-[2-(cyclohexylamino)-2-oxoethyl]-N'-(4-fluorophenyl)-N-(4-methyl-1,3-thiazol-2-yl)butanediamide;oxalic acid |
| SMILES | Cc1csc(NC(=O)CCC(=O)N(CC(=O)NC2CCCCC2)c2ccc(F)cc2)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H27FN4O3S.C2H2O4/c1-15-14-31-22(24-15)26-19(28)11-12-21(30)27(18-9-7-16(23)8-10-18)13-20(29)25-17-5-3-2-4-6-17;3-1(4)2(5)6/h7-10,14,17H,2-6,11-13H2,1H3,(H,25,29)(H,24,26,28);(H,3,4)(H,5,6) |
| InChIKey | VZIWNWGKDVBQKU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 166.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|