C25H31FN4O7S — CID 175654315
N'-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-N,N-dimethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 175654315) has the molecular formula C25H31FN4O7S and a molecular weight of 550.61 g/mol. Its IUPAC name is N'-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-N,N-dimethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N'-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-N,N-dimethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 175654315 |
| Molecular Formula | C25H31FN4O7S |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | N'-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-N,N-dimethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN(C)CCN(Cc1cnn(-c2ccc(F)cc2)c1)Cc1cccs1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H23FN4S.C6H8O7/c1-22(2)9-10-23(15-19-4-3-11-25-19)13-16-12-21-24(14-16)18-7-5-17(20)6-8-18;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-8,11-12,14H,9-10,13,15H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | QUULHZSJCRMEDI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |