C21H32N4O7S — CID 171700597
N'-[(2,3-dimethylimidazol-4-yl)methyl]-N,N-dimethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 171700597) has the molecular formula C21H32N4O7S and a molecular weight of 484.58 g/mol. Its IUPAC name is N'-[(2,3-dimethylimidazol-4-yl)methyl]-N,N-dimethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N'-[(2,3-dimethylimidazol-4-yl)methyl]-N,N-dimethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 171700597 |
| Molecular Formula | C21H32N4O7S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N'-[(2,3-dimethylimidazol-4-yl)methyl]-N,N-dimethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | Cc1ncc(CN(CCN(C)C)Cc2cccs2)n1C.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H24N4S.C6H8O7/c1-13-16-10-14(18(13)4)11-19(8-7-17(2)3)12-15-6-5-9-20-15;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-6,9-10H,7-8,11-12H2,1-4H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | FOYYOIQZGDBLNW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |