C25H34N4O8S — CID 171672061
N,N-dimethyl-N'-[(5-methylfuran-2-yl)methyl]-N'-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]propane-1,3-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 171672061) has the molecular formula C25H34N4O8S and a molecular weight of 550.63 g/mol. Its IUPAC name is N,N-dimethyl-N'-[(5-methylfuran-2-yl)methyl]-N'-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]propane-1,3-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N,N-dimethyl-N'-[(5-methylfuran-2-yl)methyl]-N'-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]propane-1,3-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 171672061 |
| Molecular Formula | C25H34N4O8S |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | N,N-dimethyl-N'-[(5-methylfuran-2-yl)methyl]-N'-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]propane-1,3-diamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | Cc1ccc(CN(CCCN(C)C)Cc2cn[nH]c2-c2cccs2)o1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H26N4OS.C6H8O7/c1-15-7-8-17(24-15)14-23(10-5-9-22(2)3)13-16-12-20-21-19(16)18-6-4-11-25-18;7-3(8)1-6(13,5(11)12)2-4(9)10/h4,6-8,11-12H,5,9-10,13-14H2,1-3H3,(H,20,21);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | OZSMWULMPKULCP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 180.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |