C28H35NO9 — CID 175654460
2-hydroxypropane-1,2,3-tricarboxylic acid;1-[(2-hydroxy-3-prop-2-enylphenyl)methyl]-4-(4-methylphenyl)piperidin-4-ol (PubChem CID 175654460) has the molecular formula C28H35NO9 and a molecular weight of 529.59 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;1-[(2-hydroxy-3-prop-2-enylphenyl)methyl]-4-(4-methylphenyl)piperidin-4-ol.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1-[(2-hydroxy-3-prop-2-enylphenyl)methyl]-4-(4-methylphenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 175654460 |
| Molecular Formula | C28H35NO9 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1-[(2-hydroxy-3-prop-2-enylphenyl)methyl]-4-(4-methylphenyl)piperidin-4-ol |
| SMILES | C=CCc1cccc(CN2CCC(O)(c3ccc(C)cc3)CC2)c1O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H27NO2.C6H8O7/c1-3-5-18-6-4-7-19(21(18)24)16-23-14-12-22(25,13-15-23)20-10-8-17(2)9-11-20;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-4,6-11,24-25H,1,5,12-16H2,2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | UXAXOVMCOUSCJY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 175.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|