C17H18ClN5OS2 — CID 175656571
3-chloro-1-[4-[3-(1,3-thiazol-2-ylamino)-[1,2]thiazolo[5,4-b]pyridin-6-yl]piperidin-1-yl]propan-1-one (PubChem CID 175656571) has the molecular formula C17H18ClN5OS2 and a molecular weight of 407.95 g/mol. Its IUPAC name is 3-chloro-1-[4-[3-(1,3-thiazol-2-ylamino)-[1,2]thiazolo[5,4-b]pyridin-6-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-chloro-1-[4-[3-(1,3-thiazol-2-ylamino)-[1,2]thiazolo[5,4-b]pyridin-6-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 175656571 |
| Molecular Formula | C17H18ClN5OS2 |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 3-chloro-1-[4-[3-(1,3-thiazol-2-ylamino)-[1,2]thiazolo[5,4-b]pyridin-6-yl]piperidin-1-yl]propan-1-one |
| SMILES | O=C(CCCl)N1CCC(c2ccc3c(Nc4nccs4)nsc3n2)CC1 |
| InChI | InChI=1S/C17H18ClN5OS2/c18-6-3-14(24)23-8-4-11(5-9-23)13-2-1-12-15(22-26-16(12)20-13)21-17-19-7-10-25-17/h1-2,7,10-11H,3-6,8-9H2,(H,19,21,22) |
| InChIKey | XPGUDCGCMXGZEM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|