C16H20ClN5OS — CID 175657223
3-chloro-1-[4-[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazin-2-yl]piperidin-1-yl]propan-1-one (PubChem CID 175657223) has the molecular formula C16H20ClN5OS and a molecular weight of 365.89 g/mol. Its IUPAC name is 3-chloro-1-[4-[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazin-2-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-chloro-1-[4-[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazin-2-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 175657223 |
| Molecular Formula | C16H20ClN5OS |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 3-chloro-1-[4-[3-[(5-methyl-1,3-thiazol-2-yl)amino]pyrazin-2-yl]piperidin-1-yl]propan-1-one |
| SMILES | Cc1cnc(Nc2nccnc2C2CCN(C(=O)CCCl)CC2)s1 |
| InChI | InChI=1S/C16H20ClN5OS/c1-11-10-20-16(24-11)21-15-14(18-6-7-19-15)12-3-8-22(9-4-12)13(23)2-5-17/h6-7,10,12H,2-5,8-9H2,1H3,(H,19,20,21) |
| InChIKey | NURNICYVPPRACH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|