C25H29N3O3 — CID 175656864
(3aS,4S,6aR)-2-[(2,7-dimethoxyquinolin-3-yl)methyl]-4-(5-methyl-2-pyridinyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol (PubChem CID 175656864) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is (3aS,4S,6aR)-2-[(2,7-dimethoxyquinolin-3-yl)methyl]-4-(5-methyl-2-pyridinyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol.
| Compound Name | (3aS,4S,6aR)-2-[(2,7-dimethoxyquinolin-3-yl)methyl]-4-(5-methyl-2-pyridinyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 175656864 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (3aS,4S,6aR)-2-[(2,7-dimethoxyquinolin-3-yl)methyl]-4-(5-methyl-2-pyridinyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
| SMILES | COc1ccc2cc(CN3C[C@@H]4CC[C@@](O)(c5ccc(C)cn5)[C@@H]4C3)c(OC)nc2c1 |
| InChI | InChI=1S/C25H29N3O3/c1-16-4-7-23(26-12-16)25(29)9-8-18-13-28(15-21(18)25)14-19-10-17-5-6-20(30-2)11-22(17)27-24(19)31-3/h4-7,10-12,18,21,29H,8-9,13-15H2,1-3H3/t18-,21+,25-/m0/s1 |
| InChIKey | KYIHIPBAFPMBSP-HCYUJWNOSA-N |
| XLogP | 3.69 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |