C23H30FN3O4 — CID 92593333
(3aR,4R,6aS)-4-(2,4-diethoxypyrimidin-5-yl)-2-[(2-fluoro-4-methoxyphenyl)methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol (PubChem CID 92593333) has the molecular formula C23H30FN3O4 and a molecular weight of 431.51 g/mol. Its IUPAC name is (3aR,4R,6aS)-4-(2,4-diethoxypyrimidin-5-yl)-2-[(2-fluoro-4-methoxyphenyl)methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol.
| Compound Name | (3aR,4R,6aS)-4-(2,4-diethoxypyrimidin-5-yl)-2-[(2-fluoro-4-methoxyphenyl)methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 92593333 |
| Molecular Formula | C23H30FN3O4 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (3aR,4R,6aS)-4-(2,4-diethoxypyrimidin-5-yl)-2-[(2-fluoro-4-methoxyphenyl)methyl]-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
| SMILES | CCOc1ncc([C@@]2(O)CC[C@@H]3CN(Cc4ccc(OC)cc4F)C[C@@H]32)c(OCC)n1 |
| InChI | InChI=1S/C23H30FN3O4/c1-4-30-21-18(11-25-22(26-21)31-5-2)23(28)9-8-15-12-27(14-19(15)23)13-16-6-7-17(29-3)10-20(16)24/h6-7,10-11,15,19,28H,4-5,8-9,12-14H2,1-3H3/t15-,19+,23+/m1/s1 |
| InChIKey | XBXLGBKUYWWSJC-VVWXKSFDSA-N |
| XLogP | 3.15 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |