C17H20N4O2S — CID 175658374
4-(2-phenylethyl)-1-(1,3-thiazole-4-carbonyl)piperazine-2-carboxamide (PubChem CID 175658374) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-(2-phenylethyl)-1-(1,3-thiazole-4-carbonyl)piperazine-2-carboxamide.
| Compound Name | 4-(2-phenylethyl)-1-(1,3-thiazole-4-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 175658374 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-(2-phenylethyl)-1-(1,3-thiazole-4-carbonyl)piperazine-2-carboxamide |
| SMILES | NC(=O)C1CN(CCc2ccccc2)CCN1C(=O)c1cscn1 |
| InChI | InChI=1S/C17H20N4O2S/c18-16(22)15-10-20(7-6-13-4-2-1-3-5-13)8-9-21(15)17(23)14-11-24-12-19-14/h1-5,11-12,15H,6-10H2,(H2,18,22) |
| InChIKey | JHRNVWUZFLOHEO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |