C21H28N4O4 — CID 175658819
1-[3-(2,6-dioxopiperidin-1-yl)propanoyl]-4-(2-phenylethyl)piperazine-2-carboxamide (PubChem CID 175658819) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-[3-(2,6-dioxopiperidin-1-yl)propanoyl]-4-(2-phenylethyl)piperazine-2-carboxamide.
| Compound Name | 1-[3-(2,6-dioxopiperidin-1-yl)propanoyl]-4-(2-phenylethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 175658819 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-[3-(2,6-dioxopiperidin-1-yl)propanoyl]-4-(2-phenylethyl)piperazine-2-carboxamide |
| SMILES | NC(=O)C1CN(CCc2ccccc2)CCN1C(=O)CCN1C(=O)CCCC1=O |
| InChI | InChI=1S/C21H28N4O4/c22-21(29)17-15-23(11-9-16-5-2-1-3-6-16)13-14-24(17)20(28)10-12-25-18(26)7-4-8-19(25)27/h1-3,5-6,17H,4,7-15H2,(H2,22,29) |
| InChIKey | KQUQRRYBDOQVBL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|