C19H24N4O5 — CID 124958127
(2R)-1-benzyl-4-[3-(3,5-dioxomorpholin-4-yl)propanoyl]piperazine-2-carboxamide (PubChem CID 124958127) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is (2R)-1-benzyl-4-[3-(3,5-dioxomorpholin-4-yl)propanoyl]piperazine-2-carboxamide.
| Compound Name | (2R)-1-benzyl-4-[3-(3,5-dioxomorpholin-4-yl)propanoyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 124958127 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (2R)-1-benzyl-4-[3-(3,5-dioxomorpholin-4-yl)propanoyl]piperazine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CN(C(=O)CCN2C(=O)COCC2=O)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C19H24N4O5/c20-19(27)15-11-22(9-8-21(15)10-14-4-2-1-3-5-14)16(24)6-7-23-17(25)12-28-13-18(23)26/h1-5,15H,6-13H2,(H2,20,27)/t15-/m1/s1 |
| InChIKey | GEALZSFZKZVQIJ-OAHLLOKOSA-N |
| XLogP | -1.04 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|