C21H23ClN2O2 — CID 175658547
4-(4-chloro-3,5-dimethylphenoxy)-2-cyano-N-(1-phenylethyl)butanamide (PubChem CID 175658547) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylphenoxy)-2-cyano-N-(1-phenylethyl)butanamide.
| Compound Name | 4-(4-chloro-3,5-dimethylphenoxy)-2-cyano-N-(1-phenylethyl)butanamide |
|---|---|
| PubChem CID | 175658547 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylphenoxy)-2-cyano-N-(1-phenylethyl)butanamide |
| SMILES | Cc1cc(OCCC(C#N)C(=O)NC(C)c2ccccc2)cc(C)c1Cl |
| InChI | InChI=1S/C21H23ClN2O2/c1-14-11-19(12-15(2)20(14)22)26-10-9-18(13-23)21(25)24-16(3)17-7-5-4-6-8-17/h4-8,11-12,16,18H,9-10H2,1-3H3,(H,24,25) |
| InChIKey | GTTHLBADDDKFNX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |