C16H15FO2 — CID 175659373
(2S,3R)-2-[(3-fluorophenyl)methyl]-2-methyl-3H-1-benzofuran-3-ol (PubChem CID 175659373) has the molecular formula C16H15FO2 and a molecular weight of 258.29 g/mol. Its IUPAC name is (2S,3R)-2-[(3-fluorophenyl)methyl]-2-methyl-3H-1-benzofuran-3-ol.
| Compound Name | (2S,3R)-2-[(3-fluorophenyl)methyl]-2-methyl-3H-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 175659373 |
| Molecular Formula | C16H15FO2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (2S,3R)-2-[(3-fluorophenyl)methyl]-2-methyl-3H-1-benzofuran-3-ol |
| SMILES | C[C@@]1(Cc2cccc(F)c2)Oc2ccccc2[C@H]1O |
| InChI | InChI=1S/C16H15FO2/c1-16(10-11-5-4-6-12(17)9-11)15(18)13-7-2-3-8-14(13)19-16/h2-9,15,18H,10H2,1H3/t15-,16+/m1/s1 |
| InChIKey | PMVMKOIUCFQVCC-CVEARBPZSA-N |
| XLogP | 3.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |