C14H18N2O2 — CID 175660521
(4aR,8aR)-8a-methyl-4-phenyl-5,6,7,8-tetrahydro-4aH-pyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 175660521) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (4aR,8aR)-8a-methyl-4-phenyl-5,6,7,8-tetrahydro-4aH-pyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR,8aR)-8a-methyl-4-phenyl-5,6,7,8-tetrahydro-4aH-pyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 175660521 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (4aR,8aR)-8a-methyl-4-phenyl-5,6,7,8-tetrahydro-4aH-pyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | C[C@@]12CCNC[C@H]1N(c1ccccc1)C(=O)CO2 |
| InChI | InChI=1S/C14H18N2O2/c1-14-7-8-15-9-12(14)16(13(17)10-18-14)11-5-3-2-4-6-11/h2-6,12,15H,7-10H2,1H3/t12-,14-/m1/s1 |
| InChIKey | MCZNCHYHSHXQCG-TZMCWYRMSA-N |
| XLogP | 1.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |