C14H19BrN2O3 — CID 175666061
2-bromo-5,6-dimethyl-3-(2-morpholin-4-ylethylamino)cyclohexa-2,5-diene-1,4-dione (PubChem CID 175666061) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 2-bromo-5,6-dimethyl-3-(2-morpholin-4-ylethylamino)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-bromo-5,6-dimethyl-3-(2-morpholin-4-ylethylamino)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 175666061 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-bromo-5,6-dimethyl-3-(2-morpholin-4-ylethylamino)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(NCCN2CCOCC2)=C(Br)C1=O |
| InChI | InChI=1S/C14H19BrN2O3/c1-9-10(2)14(19)12(11(15)13(9)18)16-3-4-17-5-7-20-8-6-17/h16H,3-8H2,1-2H3 |
| InChIKey | PGSFGJKEXODHNS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|