C19H25N3O7S — CID 175667223
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2,4,8,8-tetraoxo-8λ6-thia-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 175667223) has the molecular formula C19H25N3O7S and a molecular weight of 439.49 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2,4,8,8-tetraoxo-8λ6-thia-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2,4,8,8-tetraoxo-8λ6-thia-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 175667223 |
| Molecular Formula | C19H25N3O7S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2,4,8,8-tetraoxo-8λ6-thia-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | COc1ccc(CCNC(=O)CN2C(=O)NC3(CCS(=O)(=O)CC3)C2=O)cc1OC |
| InChI | InChI=1S/C19H25N3O7S/c1-28-14-4-3-13(11-15(14)29-2)5-8-20-16(23)12-22-17(24)19(21-18(22)25)6-9-30(26,27)10-7-19/h3-4,11H,5-10,12H2,1-2H3,(H,20,23)(H,21,25) |
| InChIKey | NZAPTZRCQASUGH-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|