C12H15NO5S — CID 175673901
3-[5-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carbonyl]oxybutanoic acid (PubChem CID 175673901) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 3-[5-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carbonyl]oxybutanoic acid.
| Compound Name | 3-[5-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carbonyl]oxybutanoic acid |
|---|---|
| PubChem CID | 175673901 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3-[5-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carbonyl]oxybutanoic acid |
| SMILES | CC(CC(=O)O)OC(=O)c1ncsc1[C@H]1CCCO1 |
| InChI | InChI=1S/C12H15NO5S/c1-7(5-9(14)15)18-12(16)10-11(19-6-13-10)8-3-2-4-17-8/h6-8H,2-5H2,1H3,(H,14,15)/t7?,8-/m1/s1 |
| InChIKey | GJWYUWIQJXILDM-BRFYHDHCSA-N |
| XLogP | 2.01 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |