C21H30N4O10 — CID 175676840
1-[(2R,4S,5R)-4-hydroxy-5-[[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-3-yl]oxymethoxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 175676840) has the molecular formula C21H30N4O10 and a molecular weight of 498.49 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-[[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-3-yl]oxymethoxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-[[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-3-yl]oxymethoxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175676840 |
| Molecular Formula | C21H30N4O10 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-[[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-3-yl]oxymethoxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COCO[C@H]3C[C@H](N4CC(C)C(=O)NC4=O)O[C@@H]3CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H30N4O10/c1-10-5-24(20(30)22-18(10)28)16-3-12(27)15(35-16)8-32-9-33-13-4-17(34-14(13)7-26)25-6-11(2)19(29)23-21(25)31/h5,11-17,26-27H,3-4,6-9H2,1-2H3,(H,22,28,30)(H,23,29,31)/t11?,12-,13-,14+,15+,16+,17+/m0/s1 |
| InChIKey | MXDGTSZOOVPCAZ-RODAXORYSA-N |
| XLogP | -1.85 |
| TPSA | 181.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|