C18H20F2N2O — CID 175680539
N-cyclohexyl-1-[(2,6-difluorophenyl)methyl]pyrrole-3-carboxamide (PubChem CID 175680539) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is N-cyclohexyl-1-[(2,6-difluorophenyl)methyl]pyrrole-3-carboxamide.
| Compound Name | N-cyclohexyl-1-[(2,6-difluorophenyl)methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175680539 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-cyclohexyl-1-[(2,6-difluorophenyl)methyl]pyrrole-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccn(Cc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C18H20F2N2O/c19-16-7-4-8-17(20)15(16)12-22-10-9-13(11-22)18(23)21-14-5-2-1-3-6-14/h4,7-11,14H,1-3,5-6,12H2,(H,21,23) |
| InChIKey | MTUCAQQSHARHPG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |