C16H17N3O17P3-3 — CID 175683735
[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-[(2-nitrophenyl)methoxy]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate (PubChem CID 175683735) has the molecular formula C16H17N3O17P3-3 and a molecular weight of 616.24 g/mol. Its IUPAC name is [[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-[(2-nitrophenyl)methoxy]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate.
| Compound Name | [[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-[(2-nitrophenyl)methoxy]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 175683735 |
| Molecular Formula | C16H17N3O17P3-3 |
| Molecular Weight | 616.24 g/mol |
| Exact Mass | 615.98 |
| IUPAC Name | [[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[4-[(2-nitrophenyl)methoxy]-2-oxopyrimidin-1-yl]oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
| SMILES | O=c1nc(OCc2ccccc2[N+](=O)[O-])ccn1[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H20N3O17P3/c20-13-11(8-33-38(28,29)36-39(30,31)35-37(25,26)27)34-15(14(13)21)18-6-5-12(17-16(18)22)32-7-9-3-1-2-4-10(9)19(23)24/h1-6,11,13-15,20-21H,7-8H2,(H,28,29)(H,30,31)(H2,25,26,27)/p-3/t11-,13-,14-,15-/m1/s1 |
| InChIKey | RYYMQEJALABJPN-NMFUWQPSSA-K |
| XLogP | -2.20 |
| TPSA | 305.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.24 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|