C13H23N4O11P2- — CID 24867839
[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] (trimethylazaniumyl)methyl phosphate (PubChem CID 24867839) has the molecular formula C13H23N4O11P2- and a molecular weight of 473.29 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] (trimethylazaniumyl)methyl phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] (trimethylazaniumyl)methyl phosphate |
|---|---|
| PubChem CID | 24867839 |
| Molecular Formula | C13H23N4O11P2- |
| Molecular Weight | 473.29 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] (trimethylazaniumyl)methyl phosphate |
| SMILES | C[N+](C)(C)COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H24N4O11P2/c1-17(2,3)7-26-30(23,24)28-29(21,22)25-6-8-10(18)11(19)12(27-8)16-5-4-9(14)15-13(16)20/h4-5,8,10-12,18-19H,6-7H2,1-3H3,(H3-,14,15,20,21,22,23,24)/p-1/t8-,10-,11-,12-/m1/s1 |
| InChIKey | NTUKWLVBPUVIED-HJQYOEGKSA-M |
| XLogP | -2.90 |
| TPSA | 218.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.29 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|