C13H25N4NaO11P2+2 — CID 126456759
sodium [[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl-trimethylazanium (PubChem CID 126456759) has the molecular formula C13H25N4NaO11P2+2 and a molecular weight of 498.30 g/mol. Its IUPAC name is sodium [[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl-trimethylazanium.
| Compound Name | sodium [[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl-trimethylazanium |
|---|---|
| PubChem CID | 126456759 |
| Molecular Formula | C13H25N4NaO11P2+2 |
| Molecular Weight | 498.30 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | sodium [[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl-trimethylazanium |
| SMILES | C[N+](C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C13H24N4O11P2.Na/c1-17(2,3)7-26-30(23,24)28-29(21,22)25-6-8-10(18)11(19)12(27-8)16-5-4-9(14)15-13(16)20;/h4-5,8,10-12,18-19H,6-7H2,1-3H3,(H3-,14,15,20,21,22,23,24);/q;+1/p+1/t8-,10-,11-,12-;/m1./s1 |
| InChIKey | OJIUVDOCCXPPHK-WNEHWFFFSA-O |
| XLogP | -4.64 |
| TPSA | 212.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.30 |
| LogP ≤ 5 | -4.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|