C12H24N4O12P2 — CID 87794079
[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (trimethylazaniumyl) phosphate;hydrate (PubChem CID 87794079) has the molecular formula C12H24N4O12P2 and a molecular weight of 478.29 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (trimethylazaniumyl) phosphate;hydrate.
| Compound Name | [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (trimethylazaniumyl) phosphate;hydrate |
|---|---|
| PubChem CID | 87794079 |
| Molecular Formula | C12H24N4O12P2 |
| Molecular Weight | 478.29 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (trimethylazaniumyl) phosphate;hydrate |
| SMILES | C[N+](C)(C)OP(=O)([O-])OP(=O)(O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O.O |
| InChI | InChI=1S/C12H22N4O11P2.H2O/c1-16(2,3)26-29(22,23)27-28(20,21)24-6-7-9(17)10(18)11(25-7)15-5-4-8(13)14-12(15)19;/h4-5,7,9-11,17-18H,6H2,1-3H3,(H3-,13,14,19,20,21,22,23);1H2/t7-,9-,10-,11-;/m1./s1 |
| InChIKey | JRFPOLTUZVLGQA-VYFIMUGFSA-N |
| XLogP | -3.14 |
| TPSA | 247.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.29 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|