C12H13BrINO2 — CID 175686803
2-(3-bromo-5-iodophenoxy)-N-cyclobutylacetamide (PubChem CID 175686803) has the molecular formula C12H13BrINO2 and a molecular weight of 410.05 g/mol. Its IUPAC name is 2-(3-bromo-5-iodophenoxy)-N-cyclobutylacetamide.
| Compound Name | 2-(3-bromo-5-iodophenoxy)-N-cyclobutylacetamide |
|---|---|
| PubChem CID | 175686803 |
| Molecular Formula | C12H13BrINO2 |
| Molecular Weight | 410.05 g/mol |
| Exact Mass | 408.92 |
| IUPAC Name | 2-(3-bromo-5-iodophenoxy)-N-cyclobutylacetamide |
| SMILES | O=C(COc1cc(Br)cc(I)c1)NC1CCC1 |
| InChI | InChI=1S/C12H13BrINO2/c13-8-4-9(14)6-11(5-8)17-7-12(16)15-10-2-1-3-10/h4-6,10H,1-3,7H2,(H,15,16) |
| InChIKey | FDTCQWXAJUKMJK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.05 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|