C12H16BrIN2O2 — CID 175686805
2-(3-bromo-5-iodophenoxy)-N-[2-(dimethylamino)ethyl]acetamide (PubChem CID 175686805) has the molecular formula C12H16BrIN2O2 and a molecular weight of 427.08 g/mol. Its IUPAC name is 2-(3-bromo-5-iodophenoxy)-N-[2-(dimethylamino)ethyl]acetamide.
| Compound Name | 2-(3-bromo-5-iodophenoxy)-N-[2-(dimethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 175686805 |
| Molecular Formula | C12H16BrIN2O2 |
| Molecular Weight | 427.08 g/mol |
| Exact Mass | 425.94 |
| IUPAC Name | 2-(3-bromo-5-iodophenoxy)-N-[2-(dimethylamino)ethyl]acetamide |
| SMILES | CN(C)CCNC(=O)COc1cc(Br)cc(I)c1 |
| InChI | InChI=1S/C12H16BrIN2O2/c1-16(2)4-3-15-12(17)8-18-11-6-9(13)5-10(14)7-11/h5-7H,3-4,8H2,1-2H3,(H,15,17) |
| InChIKey | VMKRMWSQAIOHEV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.08 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|