C11H17N2+ — CID 175687084
[5-(dimethylaminomethylidene)cyclopenta-1,3-dien-1-yl]methylidene-dimethylazanium (PubChem CID 175687084) has the molecular formula C11H17N2+ and a molecular weight of 177.27 g/mol. Its IUPAC name is [5-(dimethylaminomethylidene)cyclopenta-1,3-dien-1-yl]methylidene-dimethylazanium.
| Compound Name | [5-(dimethylaminomethylidene)cyclopenta-1,3-dien-1-yl]methylidene-dimethylazanium |
|---|---|
| PubChem CID | 175687084 |
| Molecular Formula | C11H17N2+ |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.14 |
| IUPAC Name | [5-(dimethylaminomethylidene)cyclopenta-1,3-dien-1-yl]methylidene-dimethylazanium |
| SMILES | CN(C)C=C1C=CC=C1C=[N+](C)C |
| InChI | InChI=1S/C11H17N2/c1-12(2)8-10-6-5-7-11(10)9-13(3)4/h5-9H,1-4H3/q+1 |
| InChIKey | RRJZFMWBVJGRNB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|