C11H13ClF6N2O3S — CID 175688148
N',N'-bis(trifluoromethyl)propane-1,3-diamine;4-chlorobenzenesulfonic acid (PubChem CID 175688148) has the molecular formula C11H13ClF6N2O3S and a molecular weight of 402.74 g/mol. Its IUPAC name is N',N'-bis(trifluoromethyl)propane-1,3-diamine;4-chlorobenzenesulfonic acid.
| Compound Name | N',N'-bis(trifluoromethyl)propane-1,3-diamine;4-chlorobenzenesulfonic acid |
|---|---|
| PubChem CID | 175688148 |
| Molecular Formula | C11H13ClF6N2O3S |
| Molecular Weight | 402.74 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | N',N'-bis(trifluoromethyl)propane-1,3-diamine;4-chlorobenzenesulfonic acid |
| SMILES | NCCCN(C(F)(F)F)C(F)(F)F.O=S(=O)(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H5ClO3S.C5H8F6N2/c7-5-1-3-6(4-2-5)11(8,9)10;6-4(7,8)13(3-1-2-12)5(9,10)11/h1-4H,(H,8,9,10);1-3,12H2 |
| InChIKey | SCIFHBSVOWOLCN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|