About 2-azabicyclo[2.2.1]heptane;azane;hydrate
2-azabicyclo[2.2.1]heptane;azane;hydrate (PubChem CID 175690647) has the molecular formula C6H16N2O
and a molecular weight of 132.21 g/mol. Its IUPAC name is 2-azabicyclo[2.2.1]heptane;azane;hydrate.
Molecular Properties
| Compound Name | 2-azabicyclo[2.2.1]heptane;azane;hydrate |
| PubChem CID | 175690647 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | 2-azabicyclo[2.2.1]heptane;azane;hydrate |
| SMILES | C1CC2CC1CN2.N.O |
| InChI | InChI=1S/C6H11N.H3N.H2O/c1-2-6-3-5(1)4-7-6;;/h5-7H,1-4H2;1H3;1H2 |
| InChIKey | QKYFVBXWPBEFID-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-azabicyclo[2.2.1]heptane;azane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[2.2.1]heptane;azane;hydrate?
The IUPAC name of 2-azabicyclo[2.2.1]heptane;azane;hydrate (CID 175690647) is 2-azabicyclo[2.2.1]heptane;azane;hydrate.
What is the SMILES notation for 2-azabicyclo[2.2.1]heptane;azane;hydrate?
The canonical SMILES for 2-azabicyclo[2.2.1]heptane;azane;hydrate is C1CC2CC1CN2.N.O.
What is the InChIKey of 2-azabicyclo[2.2.1]heptane;azane;hydrate?
The InChIKey is QKYFVBXWPBEFID-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.H3N.H2O/c1-2-6-3-5(1)4-7-6;;/h5-7H,1-4H2;1H3;1H2.
What are the key properties of 2-azabicyclo[2.2.1]heptane;azane;hydrate?
2-azabicyclo[2.2.1]heptane;azane;hydrate has a molecular weight of 132.21 g/mol, XLogP of 0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[2.2.1]heptane;azane;hydrate is sourced from PubChem (CID 175690647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).