About 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate
2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate (PubChem CID 175847987) has the molecular formula C10H17NO4Pd
and a molecular weight of 321.67 g/mol. Its IUPAC name is 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate.
Molecular Properties
| Compound Name | 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate |
| PubChem CID | 175847987 |
| Molecular Formula | C10H17NO4Pd |
| Molecular Weight | 321.67 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate |
| SMILES | C1CC2CC1CN2.CC(=O)[O-].CC(=O)[O-].[Pd+2] |
| InChI | InChI=1S/C6H11N.2C2H4O2.Pd/c1-2-6-3-5(1)4-7-6;2*1-2(3)4;/h5-7H,1-4H2;2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | USUAHVYCFCGQGI-UHFFFAOYSA-L |
| XLogP | -1.73 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.67 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate?
The IUPAC name of 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate (CID 175847987) is 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate.
What is the SMILES notation for 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate?
The canonical SMILES for 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate is C1CC2CC1CN2.CC(=O)[O-].CC(=O)[O-].[Pd+2].
What is the InChIKey of 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate?
The InChIKey is USUAHVYCFCGQGI-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H11N.2C2H4O2.Pd/c1-2-6-3-5(1)4-7-6;2*1-2(3)4;/h5-7H,1-4H2;2*1H3,(H,3,4);/q;;;+2/p-2.
What are the key properties of 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate?
2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate has a molecular weight of 321.67 g/mol, XLogP of -1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[2.2.1]heptane;palladium(2+);diacetate is sourced from PubChem (CID 175847987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).