About [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate
[heptyl(dimethyl)silyl] N-trimethylsilylethanimidate (PubChem CID 175690698) has the molecular formula C14H33NOSi2
and a molecular weight of 287.60 g/mol. Its IUPAC name is [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate.
Molecular Properties
| Compound Name | [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate |
| PubChem CID | 175690698 |
| Molecular Formula | C14H33NOSi2 |
| Molecular Weight | 287.60 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate |
| SMILES | CCCCCCC[Si](C)(C)OC(C)=N[Si](C)(C)C |
| InChI | InChI=1S/C14H33NOSi2/c1-8-9-10-11-12-13-18(6,7)16-14(2)15-17(3,4)5/h8-13H2,1-7H3 |
| InChIKey | FZQJLMQQDVDJLA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate?
The IUPAC name of [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate (CID 175690698) is [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate.
What is the SMILES notation for [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate?
The canonical SMILES for [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate is CCCCCCC[Si](C)(C)OC(C)=N[Si](C)(C)C.
What is the InChIKey of [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate?
The InChIKey is FZQJLMQQDVDJLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H33NOSi2/c1-8-9-10-11-12-13-18(6,7)16-14(2)15-17(3,4)5/h8-13H2,1-7H3.
What are the key properties of [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate?
[heptyl(dimethyl)silyl] N-trimethylsilylethanimidate has a molecular weight of 287.60 g/mol, XLogP of 5.43, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [heptyl(dimethyl)silyl] N-trimethylsilylethanimidate is sourced from PubChem (CID 175690698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).