C7H12FN — CID 175691789
(2R,5S)-2-fluoro-8-azabicyclo[3.2.1]octane (PubChem CID 175691789) has the molecular formula C7H12FN and a molecular weight of 129.18 g/mol. Its IUPAC name is (2R,5S)-2-fluoro-8-azabicyclo[3.2.1]octane.
| Compound Name | (2R,5S)-2-fluoro-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 175691789 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | (2R,5S)-2-fluoro-8-azabicyclo[3.2.1]octane |
| SMILES | F[C@@H]1CC[C@@H]2CCC1N2 |
| InChI | InChI=1S/C7H12FN/c8-6-3-1-5-2-4-7(6)9-5/h5-7,9H,1-4H2/t5-,6-,7?/m1/s1 |
| InChIKey | RRCGTFHTQUKZPZ-CQMSUOBXSA-N |
| XLogP | 1.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |