C13H15NO4 — CID 175692247
5-(methoxymethoxy)-N,N-dimethyl-1-benzofuran-2-carboxamide (PubChem CID 175692247) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 5-(methoxymethoxy)-N,N-dimethyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-(methoxymethoxy)-N,N-dimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 175692247 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 5-(methoxymethoxy)-N,N-dimethyl-1-benzofuran-2-carboxamide |
| SMILES | COCOc1ccc2oc(C(=O)N(C)C)cc2c1 |
| InChI | InChI=1S/C13H15NO4/c1-14(2)13(15)12-7-9-6-10(17-8-16-3)4-5-11(9)18-12/h4-7H,8H2,1-3H3 |
| InChIKey | HTXFGRYTLJLQBT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|