C20H21ClFN5O4 — CID 175692901
methyl 3-[(3-chloro-4-fluorophenyl)carbamoyl]-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-12-carboxylate (PubChem CID 175692901) has the molecular formula C20H21ClFN5O4 and a molecular weight of 449.87 g/mol. Its IUPAC name is methyl 3-[(3-chloro-4-fluorophenyl)carbamoyl]-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-12-carboxylate.
| Compound Name | methyl 3-[(3-chloro-4-fluorophenyl)carbamoyl]-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-12-carboxylate |
|---|---|
| PubChem CID | 175692901 |
| Molecular Formula | C20H21ClFN5O4 |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | methyl 3-[(3-chloro-4-fluorophenyl)carbamoyl]-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-12-carboxylate |
| SMILES | COC(=O)C1CCn2nc3c(c2C(=O)N1C)C(C(=O)Nc1ccc(F)c(Cl)c1)NCC3 |
| InChI | InChI=1S/C20H21ClFN5O4/c1-26-14(20(30)31-2)6-8-27-17(19(26)29)15-13(25-27)5-7-23-16(15)18(28)24-10-3-4-12(22)11(21)9-10/h3-4,9,14,16,23H,5-8H2,1-2H3,(H,24,28) |
| InChIKey | ASGKIVOJZIKEFS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |