C14H10F3N3O3 — CID 175695029
5-[4-(trifluoromethoxy)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 175695029) has the molecular formula C14H10F3N3O3 and a molecular weight of 325.25 g/mol. Its IUPAC name is 5-[4-(trifluoromethoxy)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-[4-(trifluoromethoxy)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 175695029 |
| Molecular Formula | C14H10F3N3O3 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 5-[4-(trifluoromethoxy)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | O=C1CC(c2ccc(OC(F)(F)F)cc2)c2c(nc[nH]c2=O)N1 |
| InChI | InChI=1S/C14H10F3N3O3/c15-14(16,17)23-8-3-1-7(2-4-8)9-5-10(21)20-12-11(9)13(22)19-6-18-12/h1-4,6,9H,5H2,(H2,18,19,20,21,22) |
| InChIKey | XVFZFSFPJYYRPW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |