C13H9ClN4O4 — CID 175694917
5-(4-chloro-3-nitrophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 175694917) has the molecular formula C13H9ClN4O4 and a molecular weight of 320.69 g/mol. Its IUPAC name is 5-(4-chloro-3-nitrophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(4-chloro-3-nitrophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 175694917 |
| Molecular Formula | C13H9ClN4O4 |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 5-(4-chloro-3-nitrophenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | O=C1CC(c2ccc(Cl)c([N+](=O)[O-])c2)c2c(nc[nH]c2=O)N1 |
| InChI | InChI=1S/C13H9ClN4O4/c14-8-2-1-6(3-9(8)18(21)22)7-4-10(19)17-12-11(7)13(20)16-5-15-12/h1-3,5,7H,4H2,(H2,15,16,17,19,20) |
| InChIKey | LFMLMSQGFQOOOI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|